C36H33N5O5 — CID 3981253
N'-[3-methyl-2-[1-[2-(4-methylphenyl)-1H-indol-3-yl]-3-oxo-1H-isoindol-2-yl]pentanoyl]-4-nitrobenzohydrazide (PubChem CID 3981253) has the molecular formula C36H33N5O5 and a molecular weight of 615.69 g/mol. Its IUPAC name is N'-[3-methyl-2-[1-[2-(4-methylphenyl)-1H-indol-3-yl]-3-oxo-1H-isoindol-2-yl]pentanoyl]-4-nitrobenzohydrazide.
| Compound Name | N'-[3-methyl-2-[1-[2-(4-methylphenyl)-1H-indol-3-yl]-3-oxo-1H-isoindol-2-yl]pentanoyl]-4-nitrobenzohydrazide |
|---|---|
| PubChem CID | 3981253 |
| Molecular Formula | C36H33N5O5 |
| Molecular Weight | 615.69 g/mol |
| Exact Mass | 615.25 |
| IUPAC Name | N'-[3-methyl-2-[1-[2-(4-methylphenyl)-1H-indol-3-yl]-3-oxo-1H-isoindol-2-yl]pentanoyl]-4-nitrobenzohydrazide |
| SMILES | CCC(C)C(C(=O)NNC(=O)c1ccc([N+](=O)[O-])cc1)N1C(=O)c2ccccc2C1c1c(-c2ccc(C)cc2)[nH]c2ccccc12 |
| InChI | InChI=1S/C36H33N5O5/c1-4-22(3)32(35(43)39-38-34(42)24-17-19-25(20-18-24)41(45)46)40-33(26-9-5-6-10-27(26)36(40)44)30-28-11-7-8-12-29(28)37-31(30)23-15-13-21(2)14-16-23/h5-20,22,32-33,37H,4H2,1-3H3,(H,38,42)(H,39,43) |
| InChIKey | GABYZHLAVGUTBM-UHFFFAOYSA-N |
| XLogP | 6.47 |
| TPSA | 137.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 615.69 |
| LogP ≤ 5 | 6.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|