C30H29N5O5 — CID 5027090
N'-[3-methyl-2-[1-(2-methyl-1H-indol-3-yl)-3-oxo-1H-isoindol-2-yl]pentanoyl]-4-nitrobenzohydrazide (PubChem CID 5027090) has the molecular formula C30H29N5O5 and a molecular weight of 539.59 g/mol. Its IUPAC name is N'-[3-methyl-2-[1-(2-methyl-1H-indol-3-yl)-3-oxo-1H-isoindol-2-yl]pentanoyl]-4-nitrobenzohydrazide.
| Compound Name | N'-[3-methyl-2-[1-(2-methyl-1H-indol-3-yl)-3-oxo-1H-isoindol-2-yl]pentanoyl]-4-nitrobenzohydrazide |
|---|---|
| PubChem CID | 5027090 |
| Molecular Formula | C30H29N5O5 |
| Molecular Weight | 539.59 g/mol |
| Exact Mass | 539.22 |
| IUPAC Name | N'-[3-methyl-2-[1-(2-methyl-1H-indol-3-yl)-3-oxo-1H-isoindol-2-yl]pentanoyl]-4-nitrobenzohydrazide |
| SMILES | CCC(C)C(C(=O)NNC(=O)c1ccc([N+](=O)[O-])cc1)N1C(=O)c2ccccc2C1c1c(C)[nH]c2ccccc12 |
| InChI | InChI=1S/C30H29N5O5/c1-4-17(2)26(29(37)33-32-28(36)19-13-15-20(16-14-19)35(39)40)34-27(21-9-5-6-10-22(21)30(34)38)25-18(3)31-24-12-8-7-11-23(24)25/h5-17,26-27,31H,4H2,1-3H3,(H,32,36)(H,33,37) |
| InChIKey | VSBTXAXCXGAWBR-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 137.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.59 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|