C37H44N4O2 — CID 4302750
2-[1-(1,2-dimethylindol-3-yl)-3-oxo-1H-isoindol-2-yl]-N-[4-(3,5-dimethylpiperidin-1-yl)phenyl]-4-methylpentanamide (PubChem CID 4302750) has the molecular formula C37H44N4O2 and a molecular weight of 576.79 g/mol. Its IUPAC name is 2-[1-(1,2-dimethylindol-3-yl)-3-oxo-1H-isoindol-2-yl]-N-[4-(3,5-dimethylpiperidin-1-yl)phenyl]-4-methylpentanamide.
| Compound Name | 2-[1-(1,2-dimethylindol-3-yl)-3-oxo-1H-isoindol-2-yl]-N-[4-(3,5-dimethylpiperidin-1-yl)phenyl]-4-methylpentanamide |
|---|---|
| PubChem CID | 4302750 |
| Molecular Formula | C37H44N4O2 |
| Molecular Weight | 576.79 g/mol |
| Exact Mass | 576.35 |
| IUPAC Name | 2-[1-(1,2-dimethylindol-3-yl)-3-oxo-1H-isoindol-2-yl]-N-[4-(3,5-dimethylpiperidin-1-yl)phenyl]-4-methylpentanamide |
| SMILES | Cc1c(C2c3ccccc3C(=O)N2C(CC(C)C)C(=O)Nc2ccc(N3CC(C)CC(C)C3)cc2)c2ccccc2n1C |
| InChI | InChI=1S/C37H44N4O2/c1-23(2)19-33(36(42)38-27-15-17-28(18-16-27)40-21-24(3)20-25(4)22-40)41-35(29-11-7-8-12-30(29)37(41)43)34-26(5)39(6)32-14-10-9-13-31(32)34/h7-18,23-25,33,35H,19-22H2,1-6H3,(H,38,42) |
| InChIKey | DFZYRYHMCKHBLW-UHFFFAOYSA-N |
| XLogP | 7.57 |
| TPSA | 57.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.79 |
| LogP ≤ 5 | 7.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|