C30H31N3O3 — CID 45133704
N-(4-methoxyphenyl)-4-methyl-2-[1-(1-methylindol-3-yl)-3-oxo-1H-isoindol-2-yl]pentanamide (PubChem CID 45133704) has the molecular formula C30H31N3O3 and a molecular weight of 481.60 g/mol. Its IUPAC name is N-(4-methoxyphenyl)-4-methyl-2-[1-(1-methylindol-3-yl)-3-oxo-1H-isoindol-2-yl]pentanamide.
| Compound Name | N-(4-methoxyphenyl)-4-methyl-2-[1-(1-methylindol-3-yl)-3-oxo-1H-isoindol-2-yl]pentanamide |
|---|---|
| PubChem CID | 45133704 |
| Molecular Formula | C30H31N3O3 |
| Molecular Weight | 481.60 g/mol |
| Exact Mass | 481.24 |
| IUPAC Name | N-(4-methoxyphenyl)-4-methyl-2-[1-(1-methylindol-3-yl)-3-oxo-1H-isoindol-2-yl]pentanamide |
| SMILES | COc1ccc(NC(=O)C(CC(C)C)N2C(=O)c3ccccc3C2c2cn(C)c3ccccc23)cc1 |
| InChI | InChI=1S/C30H31N3O3/c1-19(2)17-27(29(34)31-20-13-15-21(36-4)16-14-20)33-28(23-10-5-6-11-24(23)30(33)35)25-18-32(3)26-12-8-7-9-22(25)26/h5-16,18-19,27-28H,17H2,1-4H3,(H,31,34) |
| InChIKey | XFOCUEJCJDVEAQ-UHFFFAOYSA-N |
| XLogP | 5.79 |
| TPSA | 63.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.60 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |