C35H33N3O3 — CID 3910004
3-methyl-2-[1-(1-methylindol-3-yl)-3-oxo-1H-isoindol-2-yl]-N-(4-phenoxyphenyl)pentanamide (PubChem CID 3910004) has the molecular formula C35H33N3O3 and a molecular weight of 543.67 g/mol. Its IUPAC name is 3-methyl-2-[1-(1-methylindol-3-yl)-3-oxo-1H-isoindol-2-yl]-N-(4-phenoxyphenyl)pentanamide.
| Compound Name | 3-methyl-2-[1-(1-methylindol-3-yl)-3-oxo-1H-isoindol-2-yl]-N-(4-phenoxyphenyl)pentanamide |
|---|---|
| PubChem CID | 3910004 |
| Molecular Formula | C35H33N3O3 |
| Molecular Weight | 543.67 g/mol |
| Exact Mass | 543.25 |
| IUPAC Name | 3-methyl-2-[1-(1-methylindol-3-yl)-3-oxo-1H-isoindol-2-yl]-N-(4-phenoxyphenyl)pentanamide |
| SMILES | CCC(C)C(C(=O)Nc1ccc(Oc2ccccc2)cc1)N1C(=O)c2ccccc2C1c1cn(C)c2ccccc12 |
| InChI | InChI=1S/C35H33N3O3/c1-4-23(2)32(34(39)36-24-18-20-26(21-19-24)41-25-12-6-5-7-13-25)38-33(28-15-8-9-16-29(28)35(38)40)30-22-37(3)31-17-11-10-14-27(30)31/h5-23,32-33H,4H2,1-3H3,(H,36,39) |
| InChIKey | VUQJVDWDRBQRDL-UHFFFAOYSA-N |
| XLogP | 7.57 |
| TPSA | 63.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.67 |
| LogP ≤ 5 | 7.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |