C32H34N4O3 — CID 4665380
4-methyl-2-[1-(1-methylindol-3-yl)-3-oxo-1H-isoindol-2-yl]-N'-(3-phenylpropanoyl)pentanehydrazide (PubChem CID 4665380) has the molecular formula C32H34N4O3 and a molecular weight of 522.65 g/mol. Its IUPAC name is 4-methyl-2-[1-(1-methylindol-3-yl)-3-oxo-1H-isoindol-2-yl]-N'-(3-phenylpropanoyl)pentanehydrazide.
| Compound Name | 4-methyl-2-[1-(1-methylindol-3-yl)-3-oxo-1H-isoindol-2-yl]-N'-(3-phenylpropanoyl)pentanehydrazide |
|---|---|
| PubChem CID | 4665380 |
| Molecular Formula | C32H34N4O3 |
| Molecular Weight | 522.65 g/mol |
| Exact Mass | 522.26 |
| IUPAC Name | 4-methyl-2-[1-(1-methylindol-3-yl)-3-oxo-1H-isoindol-2-yl]-N'-(3-phenylpropanoyl)pentanehydrazide |
| SMILES | CC(C)CC(C(=O)NNC(=O)CCc1ccccc1)N1C(=O)c2ccccc2C1c1cn(C)c2ccccc12 |
| InChI | InChI=1S/C32H34N4O3/c1-21(2)19-28(31(38)34-33-29(37)18-17-22-11-5-4-6-12-22)36-30(24-14-7-8-15-25(24)32(36)39)26-20-35(3)27-16-10-9-13-23(26)27/h4-16,20-21,28,30H,17-19H2,1-3H3,(H,33,37)(H,34,38) |
| InChIKey | NUAMPBCYUFTXRR-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 83.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.65 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|