C37H36N4O4 — CID 3604437
4-methoxy-N'-[4-methyl-2-[1-(1-methyl-2-phenylindol-3-yl)-3-oxo-1H-isoindol-2-yl]pentanoyl]benzohydrazide (PubChem CID 3604437) has the molecular formula C37H36N4O4 and a molecular weight of 600.72 g/mol. Its IUPAC name is 4-methoxy-N'-[4-methyl-2-[1-(1-methyl-2-phenylindol-3-yl)-3-oxo-1H-isoindol-2-yl]pentanoyl]benzohydrazide.
| Compound Name | 4-methoxy-N'-[4-methyl-2-[1-(1-methyl-2-phenylindol-3-yl)-3-oxo-1H-isoindol-2-yl]pentanoyl]benzohydrazide |
|---|---|
| PubChem CID | 3604437 |
| Molecular Formula | C37H36N4O4 |
| Molecular Weight | 600.72 g/mol |
| Exact Mass | 600.27 |
| IUPAC Name | 4-methoxy-N'-[4-methyl-2-[1-(1-methyl-2-phenylindol-3-yl)-3-oxo-1H-isoindol-2-yl]pentanoyl]benzohydrazide |
| SMILES | COc1ccc(C(=O)NNC(=O)C(CC(C)C)N2C(=O)c3ccccc3C2c2c(-c3ccccc3)n(C)c3ccccc23)cc1 |
| InChI | InChI=1S/C37H36N4O4/c1-23(2)22-31(36(43)39-38-35(42)25-18-20-26(45-4)21-19-25)41-34(27-14-8-9-15-28(27)37(41)44)32-29-16-10-11-17-30(29)40(3)33(32)24-12-6-5-7-13-24/h5-21,23,31,34H,22H2,1-4H3,(H,38,42)(H,39,43) |
| InChIKey | ABMOEGJVRYJIPV-UHFFFAOYSA-N |
| XLogP | 6.28 |
| TPSA | 92.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.72 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|