C31H26N2O — CID 41031713
(3S)-3-(1-methyl-2-phenylindol-3-yl)-2-[(1R)-1-phenylethyl]-3H-isoindol-1-one (PubChem CID 41031713) has the molecular formula C31H26N2O and a molecular weight of 442.56 g/mol. Its IUPAC name is (3S)-3-(1-methyl-2-phenylindol-3-yl)-2-[(1R)-1-phenylethyl]-3H-isoindol-1-one.
| Compound Name | (3S)-3-(1-methyl-2-phenylindol-3-yl)-2-[(1R)-1-phenylethyl]-3H-isoindol-1-one |
|---|---|
| PubChem CID | 41031713 |
| Molecular Formula | C31H26N2O |
| Molecular Weight | 442.56 g/mol |
| Exact Mass | 442.20 |
| IUPAC Name | (3S)-3-(1-methyl-2-phenylindol-3-yl)-2-[(1R)-1-phenylethyl]-3H-isoindol-1-one |
| SMILES | C[C@H](c1ccccc1)N1C(=O)c2ccccc2[C@H]1c1c(-c2ccccc2)n(C)c2ccccc12 |
| InChI | InChI=1S/C31H26N2O/c1-21(22-13-5-3-6-14-22)33-30(24-17-9-10-18-25(24)31(33)34)28-26-19-11-12-20-27(26)32(2)29(28)23-15-7-4-8-16-23/h3-21,30H,1-2H3/t21-,30+/m1/s1 |
| InChIKey | IGSWLYDHXHOTNU-DFXYEROKSA-N |
| XLogP | 7.15 |
| TPSA | 25.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.56 |
| LogP ≤ 5 | 7.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |