C27H29N3O4 — CID 34909592
ethyl 1-[2-[(1S)-1-(2-methyl-1H-indol-3-yl)-3-oxo-1H-isoindol-2-yl]acetyl]piperidine-4-carboxylate (PubChem CID 34909592) has the molecular formula C27H29N3O4 and a molecular weight of 459.55 g/mol. Its IUPAC name is ethyl 1-[2-[(1S)-1-(2-methyl-1H-indol-3-yl)-3-oxo-1H-isoindol-2-yl]acetyl]piperidine-4-carboxylate.
| Compound Name | ethyl 1-[2-[(1S)-1-(2-methyl-1H-indol-3-yl)-3-oxo-1H-isoindol-2-yl]acetyl]piperidine-4-carboxylate |
|---|---|
| PubChem CID | 34909592 |
| Molecular Formula | C27H29N3O4 |
| Molecular Weight | 459.55 g/mol |
| Exact Mass | 459.22 |
| IUPAC Name | ethyl 1-[2-[(1S)-1-(2-methyl-1H-indol-3-yl)-3-oxo-1H-isoindol-2-yl]acetyl]piperidine-4-carboxylate |
| SMILES | CCOC(=O)C1CCN(C(=O)CN2C(=O)c3ccccc3[C@H]2c2c(C)[nH]c3ccccc23)CC1 |
| InChI | InChI=1S/C27H29N3O4/c1-3-34-27(33)18-12-14-29(15-13-18)23(31)16-30-25(19-8-4-5-9-20(19)26(30)32)24-17(2)28-22-11-7-6-10-21(22)24/h4-11,18,25,28H,3,12-16H2,1-2H3/t25-/m0/s1 |
| InChIKey | WPGYJQLWAHYJMT-VWLOTQADSA-N |
| XLogP | 3.82 |
| TPSA | 82.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.55 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|