C15H20N2O4 — CID 78791788
ethyl 1-[2-(2-oxo-1-pyridinyl)acetyl]piperidine-4-carboxylate (PubChem CID 78791788) has the molecular formula C15H20N2O4 and a molecular weight of 292.33 g/mol. Its IUPAC name is ethyl 1-[2-(2-oxo-1-pyridinyl)acetyl]piperidine-4-carboxylate.
| Compound Name | ethyl 1-[2-(2-oxo-1-pyridinyl)acetyl]piperidine-4-carboxylate |
|---|---|
| PubChem CID | 78791788 |
| Molecular Formula | C15H20N2O4 |
| Molecular Weight | 292.33 g/mol |
| Exact Mass | 292.14 |
| IUPAC Name | ethyl 1-[2-(2-oxo-1-pyridinyl)acetyl]piperidine-4-carboxylate |
| SMILES | CCOC(=O)C1CCN(C(=O)Cn2ccccc2=O)CC1 |
| InChI | InChI=1S/C15H20N2O4/c1-2-21-15(20)12-6-9-16(10-7-12)14(19)11-17-8-4-3-5-13(17)18/h3-5,8,12H,2,6-7,9-11H2,1H3 |
| InChIKey | BLWLKFQZUZCRAY-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 68.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.33 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |