C22H28N2O3 — CID 46342918
ethyl 1-[3-(2-methylphenyl)-3-pyrrol-1-ylpropanoyl]piperidine-4-carboxylate (PubChem CID 46342918) has the molecular formula C22H28N2O3 and a molecular weight of 368.48 g/mol. Its IUPAC name is ethyl 1-[3-(2-methylphenyl)-3-pyrrol-1-ylpropanoyl]piperidine-4-carboxylate.
| Compound Name | ethyl 1-[3-(2-methylphenyl)-3-pyrrol-1-ylpropanoyl]piperidine-4-carboxylate |
|---|---|
| PubChem CID | 46342918 |
| Molecular Formula | C22H28N2O3 |
| Molecular Weight | 368.48 g/mol |
| Exact Mass | 368.21 |
| IUPAC Name | ethyl 1-[3-(2-methylphenyl)-3-pyrrol-1-ylpropanoyl]piperidine-4-carboxylate |
| SMILES | CCOC(=O)C1CCN(C(=O)CC(c2ccccc2C)n2cccc2)CC1 |
| InChI | InChI=1S/C22H28N2O3/c1-3-27-22(26)18-10-14-24(15-11-18)21(25)16-20(23-12-6-7-13-23)19-9-5-4-8-17(19)2/h4-9,12-13,18,20H,3,10-11,14-16H2,1-2H3 |
| InChIKey | NGOLULKPSSPJAJ-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 51.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.48 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |