C26H30N2O3 — CID 42774746
ethyl 1-[3-(1-methylindol-3-yl)-3-phenylpropanoyl]piperidine-4-carboxylate (PubChem CID 42774746) has the molecular formula C26H30N2O3 and a molecular weight of 418.54 g/mol. Its IUPAC name is ethyl 1-[3-(1-methylindol-3-yl)-3-phenylpropanoyl]piperidine-4-carboxylate.
| Compound Name | ethyl 1-[3-(1-methylindol-3-yl)-3-phenylpropanoyl]piperidine-4-carboxylate |
|---|---|
| PubChem CID | 42774746 |
| Molecular Formula | C26H30N2O3 |
| Molecular Weight | 418.54 g/mol |
| Exact Mass | 418.23 |
| IUPAC Name | ethyl 1-[3-(1-methylindol-3-yl)-3-phenylpropanoyl]piperidine-4-carboxylate |
| SMILES | CCOC(=O)C1CCN(C(=O)CC(c2ccccc2)c2cn(C)c3ccccc23)CC1 |
| InChI | InChI=1S/C26H30N2O3/c1-3-31-26(30)20-13-15-28(16-14-20)25(29)17-22(19-9-5-4-6-10-19)23-18-27(2)24-12-8-7-11-21(23)24/h4-12,18,20,22H,3,13-17H2,1-2H3 |
| InChIKey | RTMFXXUMGQDROD-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 51.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.54 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |