C31H33N3O — CID 42774763
3-(1-methylindol-3-yl)-3-phenyl-1-[4-[(E)-3-phenylprop-2-enyl]piperazin-1-yl]propan-1-one (PubChem CID 42774763) has the molecular formula C31H33N3O and a molecular weight of 463.63 g/mol. Its IUPAC name is 3-(1-methylindol-3-yl)-3-phenyl-1-[4-[(E)-3-phenylprop-2-enyl]piperazin-1-yl]propan-1-one.
| Compound Name | 3-(1-methylindol-3-yl)-3-phenyl-1-[4-[(E)-3-phenylprop-2-enyl]piperazin-1-yl]propan-1-one |
|---|---|
| PubChem CID | 42774763 |
| Molecular Formula | C31H33N3O |
| Molecular Weight | 463.63 g/mol |
| Exact Mass | 463.26 |
| IUPAC Name | 3-(1-methylindol-3-yl)-3-phenyl-1-[4-[(E)-3-phenylprop-2-enyl]piperazin-1-yl]propan-1-one |
| SMILES | Cn1cc(C(CC(=O)N2CCN(C/C=C/c3ccccc3)CC2)c2ccccc2)c2ccccc21 |
| InChI | InChI=1S/C31H33N3O/c1-32-24-29(27-16-8-9-17-30(27)32)28(26-14-6-3-7-15-26)23-31(35)34-21-19-33(20-22-34)18-10-13-25-11-4-2-5-12-25/h2-17,24,28H,18-23H2,1H3/b13-10+ |
| InChIKey | RAOAEWPPPHNTIY-JLHYYAGUSA-N |
| XLogP | 5.56 |
| TPSA | 28.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.63 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |