C27H32N2O3 — CID 24717643
ethyl 1-[3-(1-methylindol-3-yl)-3-(4-methylphenyl)propanoyl]piperidine-3-carboxylate (PubChem CID 24717643) has the molecular formula C27H32N2O3 and a molecular weight of 432.56 g/mol. Its IUPAC name is ethyl 1-[3-(1-methylindol-3-yl)-3-(4-methylphenyl)propanoyl]piperidine-3-carboxylate.
| Compound Name | ethyl 1-[3-(1-methylindol-3-yl)-3-(4-methylphenyl)propanoyl]piperidine-3-carboxylate |
|---|---|
| PubChem CID | 24717643 |
| Molecular Formula | C27H32N2O3 |
| Molecular Weight | 432.56 g/mol |
| Exact Mass | 432.24 |
| IUPAC Name | ethyl 1-[3-(1-methylindol-3-yl)-3-(4-methylphenyl)propanoyl]piperidine-3-carboxylate |
| SMILES | CCOC(=O)C1CCCN(C(=O)CC(c2ccc(C)cc2)c2cn(C)c3ccccc23)C1 |
| InChI | InChI=1S/C27H32N2O3/c1-4-32-27(31)21-8-7-15-29(17-21)26(30)16-23(20-13-11-19(2)12-14-20)24-18-28(3)25-10-6-5-9-22(24)25/h5-6,9-14,18,21,23H,4,7-8,15-17H2,1-3H3 |
| InChIKey | VRKXUWJEJIEFNI-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 51.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.56 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |