C28H28N2O2 — CID 41031824
(3S)-2-butyl-3-[2-(3-methoxyphenyl)-1-methylindol-3-yl]-3H-isoindol-1-one (PubChem CID 41031824) has the molecular formula C28H28N2O2 and a molecular weight of 424.54 g/mol. Its IUPAC name is (3S)-2-butyl-3-[2-(3-methoxyphenyl)-1-methylindol-3-yl]-3H-isoindol-1-one.
| Compound Name | (3S)-2-butyl-3-[2-(3-methoxyphenyl)-1-methylindol-3-yl]-3H-isoindol-1-one |
|---|---|
| PubChem CID | 41031824 |
| Molecular Formula | C28H28N2O2 |
| Molecular Weight | 424.54 g/mol |
| Exact Mass | 424.22 |
| IUPAC Name | (3S)-2-butyl-3-[2-(3-methoxyphenyl)-1-methylindol-3-yl]-3H-isoindol-1-one |
| SMILES | CCCCN1C(=O)c2ccccc2[C@H]1c1c(-c2cccc(OC)c2)n(C)c2ccccc12 |
| InChI | InChI=1S/C28H28N2O2/c1-4-5-17-30-27(21-13-6-7-14-22(21)28(30)31)25-23-15-8-9-16-24(23)29(2)26(25)19-11-10-12-20(18-19)32-3/h6-16,18,27H,4-5,17H2,1-3H3/t27-/m0/s1 |
| InChIKey | QSJGVFINEVQRQS-MHZLTWQESA-N |
| XLogP | 6.20 |
| TPSA | 34.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.54 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |