C35H35N3O2 — CID 11409976
1-benzyl-3-(1-pentylindol-3-yl)-4-(1-propylindol-3-yl)pyrrole-2,5-dione (PubChem CID 11409976) has the molecular formula C35H35N3O2 and a molecular weight of 529.68 g/mol. Its IUPAC name is 1-benzyl-3-(1-pentylindol-3-yl)-4-(1-propylindol-3-yl)pyrrole-2,5-dione.
| Compound Name | 1-benzyl-3-(1-pentylindol-3-yl)-4-(1-propylindol-3-yl)pyrrole-2,5-dione |
|---|---|
| PubChem CID | 11409976 |
| Molecular Formula | C35H35N3O2 |
| Molecular Weight | 529.68 g/mol |
| Exact Mass | 529.27 |
| IUPAC Name | 1-benzyl-3-(1-pentylindol-3-yl)-4-(1-propylindol-3-yl)pyrrole-2,5-dione |
| SMILES | CCCCCn1cc(C2=C(c3cn(CCC)c4ccccc34)C(=O)N(Cc3ccccc3)C2=O)c2ccccc21 |
| InChI | InChI=1S/C35H35N3O2/c1-3-5-13-21-37-24-29(27-17-10-12-19-31(27)37)33-32(28-23-36(20-4-2)30-18-11-9-16-26(28)30)34(39)38(35(33)40)22-25-14-7-6-8-15-25/h6-12,14-19,23-24H,3-5,13,20-22H2,1-2H3 |
| InChIKey | ULNMWALBTFSDGD-UHFFFAOYSA-N |
| XLogP | 7.68 |
| TPSA | 47.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.68 |
| LogP ≤ 5 | 7.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|