C23H29ClN2O — CID 23634785
1-pentyl-3-[(2-phenylethylamino)methyl]quinolin-4-one;hydrochloride (PubChem CID 23634785) has the molecular formula C23H29ClN2O and a molecular weight of 384.95 g/mol. Its IUPAC name is 1-pentyl-3-[(2-phenylethylamino)methyl]quinolin-4-one;hydrochloride.
| Compound Name | 1-pentyl-3-[(2-phenylethylamino)methyl]quinolin-4-one;hydrochloride |
|---|---|
| PubChem CID | 23634785 |
| Molecular Formula | C23H29ClN2O |
| Molecular Weight | 384.95 g/mol |
| Exact Mass | 384.20 |
| IUPAC Name | 1-pentyl-3-[(2-phenylethylamino)methyl]quinolin-4-one;hydrochloride |
| SMILES | CCCCCn1cc(CNCCc2ccccc2)c(=O)c2ccccc21.Cl |
| InChI | InChI=1S/C23H28N2O.ClH/c1-2-3-9-16-25-18-20(23(26)21-12-7-8-13-22(21)25)17-24-15-14-19-10-5-4-6-11-19;/h4-8,10-13,18,24H,2-3,9,14-17H2,1H3;1H |
| InChIKey | FZPBRVDYIATRDT-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 34.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.95 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|