C15H19F3N2 — CID 66408210
N-[[1-(3,3,3-trifluoropropyl)indol-3-yl]methyl]propan-1-amine (PubChem CID 66408210) has the molecular formula C15H19F3N2 and a molecular weight of 284.33 g/mol. Its IUPAC name is N-[[1-(3,3,3-trifluoropropyl)indol-3-yl]methyl]propan-1-amine.
| Compound Name | N-[[1-(3,3,3-trifluoropropyl)indol-3-yl]methyl]propan-1-amine |
|---|---|
| PubChem CID | 66408210 |
| Molecular Formula | C15H19F3N2 |
| Molecular Weight | 284.33 g/mol |
| Exact Mass | 284.15 |
| IUPAC Name | N-[[1-(3,3,3-trifluoropropyl)indol-3-yl]methyl]propan-1-amine |
| SMILES | CCCNCc1cn(CCC(F)(F)F)c2ccccc12 |
| InChI | InChI=1S/C15H19F3N2/c1-2-8-19-10-12-11-20(9-7-15(16,17)18)14-6-4-3-5-13(12)14/h3-6,11,19H,2,7-10H2,1H3 |
| InChIKey | AHFCLCCWLZZWGQ-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 16.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.33 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|