C18H25N3 — CID 66410175
2,2-dimethyl-4-[3-(propylaminomethyl)indol-1-yl]butanenitrile (PubChem CID 66410175) has the molecular formula C18H25N3 and a molecular weight of 283.42 g/mol. Its IUPAC name is 2,2-dimethyl-4-[3-(propylaminomethyl)indol-1-yl]butanenitrile.
| Compound Name | 2,2-dimethyl-4-[3-(propylaminomethyl)indol-1-yl]butanenitrile |
|---|---|
| PubChem CID | 66410175 |
| Molecular Formula | C18H25N3 |
| Molecular Weight | 283.42 g/mol |
| Exact Mass | 283.20 |
| IUPAC Name | 2,2-dimethyl-4-[3-(propylaminomethyl)indol-1-yl]butanenitrile |
| SMILES | CCCNCc1cn(CCC(C)(C)C#N)c2ccccc12 |
| InChI | InChI=1S/C18H25N3/c1-4-10-20-12-15-13-21(11-9-18(2,3)14-19)17-8-6-5-7-16(15)17/h5-8,13,20H,4,9-12H2,1-3H3 |
| InChIKey | KTARXYNVBYIXDV-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 40.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.42 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|