C16H25N3 — CID 119027572
N-methyl-N'-[(1-propylindol-3-yl)methyl]propane-1,3-diamine (PubChem CID 119027572) has the molecular formula C16H25N3 and a molecular weight of 259.40 g/mol. Its IUPAC name is N-methyl-N'-[(1-propylindol-3-yl)methyl]propane-1,3-diamine.
| Compound Name | N-methyl-N'-[(1-propylindol-3-yl)methyl]propane-1,3-diamine |
|---|---|
| PubChem CID | 119027572 |
| Molecular Formula | C16H25N3 |
| Molecular Weight | 259.40 g/mol |
| Exact Mass | 259.20 |
| IUPAC Name | N-methyl-N'-[(1-propylindol-3-yl)methyl]propane-1,3-diamine |
| SMILES | CCCn1cc(CNCCCNC)c2ccccc21 |
| InChI | InChI=1S/C16H25N3/c1-3-11-19-13-14(12-18-10-6-9-17-2)15-7-4-5-8-16(15)19/h4-5,7-8,13,17-18H,3,6,9-12H2,1-2H3 |
| InChIKey | DOLPUFSOQQINSZ-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 28.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.40 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|