C19H21FN2 — CID 119027513
1-(4-fluorophenyl)-N-[(1-propylindol-3-yl)methyl]methanamine (PubChem CID 119027513) has the molecular formula C19H21FN2 and a molecular weight of 296.39 g/mol. Its IUPAC name is 1-(4-fluorophenyl)-N-[(1-propylindol-3-yl)methyl]methanamine.
| Compound Name | 1-(4-fluorophenyl)-N-[(1-propylindol-3-yl)methyl]methanamine |
|---|---|
| PubChem CID | 119027513 |
| Molecular Formula | C19H21FN2 |
| Molecular Weight | 296.39 g/mol |
| Exact Mass | 296.17 |
| IUPAC Name | 1-(4-fluorophenyl)-N-[(1-propylindol-3-yl)methyl]methanamine |
| SMILES | CCCn1cc(CNCc2ccc(F)cc2)c2ccccc21 |
| InChI | InChI=1S/C19H21FN2/c1-2-11-22-14-16(18-5-3-4-6-19(18)22)13-21-12-15-7-9-17(20)10-8-15/h3-10,14,21H,2,11-13H2,1H3 |
| InChIKey | VTBODRNFZJHHCO-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 16.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.39 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |