C21H34N2 — CID 70686044
N,N-dimethyl-3-(1-octylindol-3-yl)propan-1-amine (PubChem CID 70686044) has the molecular formula C21H34N2 and a molecular weight of 314.52 g/mol. Its IUPAC name is N,N-dimethyl-3-(1-octylindol-3-yl)propan-1-amine.
| Compound Name | N,N-dimethyl-3-(1-octylindol-3-yl)propan-1-amine |
|---|---|
| PubChem CID | 70686044 |
| Molecular Formula | C21H34N2 |
| Molecular Weight | 314.52 g/mol |
| Exact Mass | 314.27 |
| IUPAC Name | N,N-dimethyl-3-(1-octylindol-3-yl)propan-1-amine |
| SMILES | CCCCCCCCn1cc(CCCN(C)C)c2ccccc21 |
| InChI | InChI=1S/C21H34N2/c1-4-5-6-7-8-11-17-23-18-19(13-12-16-22(2)3)20-14-9-10-15-21(20)23/h9-10,14-15,18H,4-8,11-13,16-17H2,1-3H3 |
| InChIKey | GOPJAMVUDGGEJQ-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 8.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.52 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|