C13H19N3 — CID 70997307
1-[3-(dimethylamino)propyl]indol-3-amine (PubChem CID 70997307) has the molecular formula C13H19N3 and a molecular weight of 217.32 g/mol. Its IUPAC name is 1-[3-(dimethylamino)propyl]indol-3-amine.
| Compound Name | 1-[3-(dimethylamino)propyl]indol-3-amine |
|---|---|
| PubChem CID | 70997307 |
| Molecular Formula | C13H19N3 |
| Molecular Weight | 217.32 g/mol |
| Exact Mass | 217.16 |
| IUPAC Name | 1-[3-(dimethylamino)propyl]indol-3-amine |
| SMILES | CN(C)CCCn1cc(N)c2ccccc21 |
| InChI | InChI=1S/C13H19N3/c1-15(2)8-5-9-16-10-12(14)11-6-3-4-7-13(11)16/h3-4,6-7,10H,5,8-9,14H2,1-2H3 |
| InChIKey | URTYNTNXUXEWFL-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 34.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.32 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |