C31H37N5O3 — CID 25028895
3-[1-[3-(dimethylamino)propyl]indol-3-yl]-4-[1-[3-(dimethylamino)propyl]-5-methoxyindol-3-yl]pyrrole-2,5-dione (PubChem CID 25028895) has the molecular formula C31H37N5O3 and a molecular weight of 527.67 g/mol. Its IUPAC name is 3-[1-[3-(dimethylamino)propyl]indol-3-yl]-4-[1-[3-(dimethylamino)propyl]-5-methoxyindol-3-yl]pyrrole-2,5-dione.
| Compound Name | 3-[1-[3-(dimethylamino)propyl]indol-3-yl]-4-[1-[3-(dimethylamino)propyl]-5-methoxyindol-3-yl]pyrrole-2,5-dione |
|---|---|
| PubChem CID | 25028895 |
| Molecular Formula | C31H37N5O3 |
| Molecular Weight | 527.67 g/mol |
| Exact Mass | 527.29 |
| IUPAC Name | 3-[1-[3-(dimethylamino)propyl]indol-3-yl]-4-[1-[3-(dimethylamino)propyl]-5-methoxyindol-3-yl]pyrrole-2,5-dione |
| SMILES | COc1ccc2c(c1)c(C1=C(c3cn(CCCN(C)C)c4ccccc34)C(=O)NC1=O)cn2CCCN(C)C |
| InChI | InChI=1S/C31H37N5O3/c1-33(2)14-8-16-35-19-24(22-10-6-7-11-26(22)35)28-29(31(38)32-30(28)37)25-20-36(17-9-15-34(3)4)27-13-12-21(39-5)18-23(25)27/h6-7,10-13,18-20H,8-9,14-17H2,1-5H3,(H,32,37,38) |
| InChIKey | XOFGXKPXEXHVRY-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 71.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.67 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|