C27H29N5O3 — CID 145482206
3-(1-butyl-5-methoxyindol-3-yl)-4-(1H-indol-3-yl)pyrrole-2,5-dione;ethanimidamide (PubChem CID 145482206) has the molecular formula C27H29N5O3 and a molecular weight of 471.56 g/mol. Its IUPAC name is 3-(1-butyl-5-methoxyindol-3-yl)-4-(1H-indol-3-yl)pyrrole-2,5-dione;ethanimidamide.
| Compound Name | 3-(1-butyl-5-methoxyindol-3-yl)-4-(1H-indol-3-yl)pyrrole-2,5-dione;ethanimidamide |
|---|---|
| PubChem CID | 145482206 |
| Molecular Formula | C27H29N5O3 |
| Molecular Weight | 471.56 g/mol |
| Exact Mass | 471.23 |
| IUPAC Name | 3-(1-butyl-5-methoxyindol-3-yl)-4-(1H-indol-3-yl)pyrrole-2,5-dione;ethanimidamide |
| SMILES | CCCCn1cc(C2=C(c3c[nH]c4ccccc34)C(=O)NC2=O)c2cc(OC)ccc21.[H]/N=C(\C)N |
| InChI | InChI=1S/C25H23N3O3.C2H6N2/c1-3-4-11-28-14-19(17-12-15(31-2)9-10-21(17)28)23-22(24(29)27-25(23)30)18-13-26-20-8-6-5-7-16(18)20;1-2(3)4/h5-10,12-14,26H,3-4,11H2,1-2H3,(H,27,29,30);1H3,(H3,3,4) |
| InChIKey | BEYKIVLLKIQCQF-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 125.99 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.56 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|