C38H33N5O4S — CID 22410276
3-[3-[2,5-dioxo-4-(5-phenylmethoxy-1H-indol-3-yl)pyrrol-3-yl]-5-phenylmethoxyindol-1-yl]propyl carbamimidothioate (PubChem CID 22410276) has the molecular formula C38H33N5O4S and a molecular weight of 655.78 g/mol. Its IUPAC name is 3-[3-[2,5-dioxo-4-(5-phenylmethoxy-1H-indol-3-yl)pyrrol-3-yl]-5-phenylmethoxyindol-1-yl]propyl carbamimidothioate.
| Compound Name | 3-[3-[2,5-dioxo-4-(5-phenylmethoxy-1H-indol-3-yl)pyrrol-3-yl]-5-phenylmethoxyindol-1-yl]propyl carbamimidothioate |
|---|---|
| PubChem CID | 22410276 |
| Molecular Formula | C38H33N5O4S |
| Molecular Weight | 655.78 g/mol |
| Exact Mass | 655.23 |
| IUPAC Name | 3-[3-[2,5-dioxo-4-(5-phenylmethoxy-1H-indol-3-yl)pyrrol-3-yl]-5-phenylmethoxyindol-1-yl]propyl carbamimidothioate |
| SMILES | [H]/N=C(\N)SCCCn1cc(C2=C(c3c[nH]c4ccc(OCc5ccccc5)cc34)C(=O)NC2=O)c2cc(OCc3ccccc3)ccc21 |
| InChI | InChI=1S/C38H33N5O4S/c39-38(40)48-17-7-16-43-21-31(29-19-27(13-15-33(29)43)47-23-25-10-5-2-6-11-25)35-34(36(44)42-37(35)45)30-20-41-32-14-12-26(18-28(30)32)46-22-24-8-3-1-4-9-24/h1-6,8-15,18-21,41H,7,16-17,22-23H2,(H3,39,40)(H,42,44,45) |
| InChIKey | LZHHRJZLKWZHRT-UHFFFAOYSA-N |
| XLogP | 6.86 |
| TPSA | 135.22 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 655.78 |
| LogP ≤ 5 | 6.86 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|