C38H34N4O4 — CID 22409597
3-[1-[2-(dimethylamino)ethyl]-5-phenylmethoxyindol-3-yl]-4-(5-phenylmethoxy-1H-indol-3-yl)pyrrole-2,5-dione (PubChem CID 22409597) has the molecular formula C38H34N4O4 and a molecular weight of 610.71 g/mol. Its IUPAC name is 3-[1-[2-(dimethylamino)ethyl]-5-phenylmethoxyindol-3-yl]-4-(5-phenylmethoxy-1H-indol-3-yl)pyrrole-2,5-dione.
| Compound Name | 3-[1-[2-(dimethylamino)ethyl]-5-phenylmethoxyindol-3-yl]-4-(5-phenylmethoxy-1H-indol-3-yl)pyrrole-2,5-dione |
|---|---|
| PubChem CID | 22409597 |
| Molecular Formula | C38H34N4O4 |
| Molecular Weight | 610.71 g/mol |
| Exact Mass | 610.26 |
| IUPAC Name | 3-[1-[2-(dimethylamino)ethyl]-5-phenylmethoxyindol-3-yl]-4-(5-phenylmethoxy-1H-indol-3-yl)pyrrole-2,5-dione |
| SMILES | CN(C)CCn1cc(C2=C(c3c[nH]c4ccc(OCc5ccccc5)cc34)C(=O)NC2=O)c2cc(OCc3ccccc3)ccc21 |
| InChI | InChI=1S/C38H34N4O4/c1-41(2)17-18-42-22-32(30-20-28(14-16-34(30)42)46-24-26-11-7-4-8-12-26)36-35(37(43)40-38(36)44)31-21-39-33-15-13-27(19-29(31)33)45-23-25-9-5-3-6-10-25/h3-16,19-22,39H,17-18,23-24H2,1-2H3,(H,40,43,44) |
| InChIKey | VTISCJXMIYEKTB-UHFFFAOYSA-N |
| XLogP | 6.41 |
| TPSA | 88.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.71 |
| LogP ≤ 5 | 6.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|