C35H34N4O4 — CID 18947115
3-[1-(2-hydroxy-3-piperidin-1-ylpropyl)-5-phenylmethoxyindol-3-yl]-4-(1H-indol-3-yl)pyrrole-2,5-dione (PubChem CID 18947115) has the molecular formula C35H34N4O4 and a molecular weight of 574.68 g/mol. Its IUPAC name is 3-[1-(2-hydroxy-3-piperidin-1-ylpropyl)-5-phenylmethoxyindol-3-yl]-4-(1H-indol-3-yl)pyrrole-2,5-dione.
| Compound Name | 3-[1-(2-hydroxy-3-piperidin-1-ylpropyl)-5-phenylmethoxyindol-3-yl]-4-(1H-indol-3-yl)pyrrole-2,5-dione |
|---|---|
| PubChem CID | 18947115 |
| Molecular Formula | C35H34N4O4 |
| Molecular Weight | 574.68 g/mol |
| Exact Mass | 574.26 |
| IUPAC Name | 3-[1-(2-hydroxy-3-piperidin-1-ylpropyl)-5-phenylmethoxyindol-3-yl]-4-(1H-indol-3-yl)pyrrole-2,5-dione |
| SMILES | O=C1NC(=O)C(c2cn(CC(O)CN3CCCCC3)c3ccc(OCc4ccccc4)cc23)=C1c1c[nH]c2ccccc12 |
| InChI | InChI=1S/C35H34N4O4/c40-24(19-38-15-7-2-8-16-38)20-39-21-29(27-17-25(13-14-31(27)39)43-22-23-9-3-1-4-10-23)33-32(34(41)37-35(33)42)28-18-36-30-12-6-5-11-26(28)30/h1,3-6,9-14,17-18,21,24,36,40H,2,7-8,15-16,19-20,22H2,(H,37,41,42) |
| InChIKey | YHDPBBSVWDCJOI-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 99.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.68 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|