C29H30N4O3 — CID 22410230
3-[1-(2-hydroxy-3-piperidin-1-ylpropyl)-6-methylindol-3-yl]-4-(1H-indol-3-yl)pyrrole-2,5-dione (PubChem CID 22410230) has the molecular formula C29H30N4O3 and a molecular weight of 482.58 g/mol. Its IUPAC name is 3-[1-(2-hydroxy-3-piperidin-1-ylpropyl)-6-methylindol-3-yl]-4-(1H-indol-3-yl)pyrrole-2,5-dione.
| Compound Name | 3-[1-(2-hydroxy-3-piperidin-1-ylpropyl)-6-methylindol-3-yl]-4-(1H-indol-3-yl)pyrrole-2,5-dione |
|---|---|
| PubChem CID | 22410230 |
| Molecular Formula | C29H30N4O3 |
| Molecular Weight | 482.58 g/mol |
| Exact Mass | 482.23 |
| IUPAC Name | 3-[1-(2-hydroxy-3-piperidin-1-ylpropyl)-6-methylindol-3-yl]-4-(1H-indol-3-yl)pyrrole-2,5-dione |
| SMILES | Cc1ccc2c(C3=C(c4c[nH]c5ccccc45)C(=O)NC3=O)cn(CC(O)CN3CCCCC3)c2c1 |
| InChI | InChI=1S/C29H30N4O3/c1-18-9-10-21-23(17-33(25(21)13-18)16-19(34)15-32-11-5-2-6-12-32)27-26(28(35)31-29(27)36)22-14-30-24-8-4-3-7-20(22)24/h3-4,7-10,13-14,17,19,30,34H,2,5-6,11-12,15-16H2,1H3,(H,31,35,36) |
| InChIKey | XSYVZVVEAMARLV-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 90.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.58 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|