C24H18F3N3O4 — CID 22409458
3-[1-(2,3-dihydroxypropyl)-6-(trifluoromethyl)indol-3-yl]-4-(1H-indol-3-yl)pyrrole-2,5-dione (PubChem CID 22409458) has the molecular formula C24H18F3N3O4 and a molecular weight of 469.42 g/mol. Its IUPAC name is 3-[1-(2,3-dihydroxypropyl)-6-(trifluoromethyl)indol-3-yl]-4-(1H-indol-3-yl)pyrrole-2,5-dione.
| Compound Name | 3-[1-(2,3-dihydroxypropyl)-6-(trifluoromethyl)indol-3-yl]-4-(1H-indol-3-yl)pyrrole-2,5-dione |
|---|---|
| PubChem CID | 22409458 |
| Molecular Formula | C24H18F3N3O4 |
| Molecular Weight | 469.42 g/mol |
| Exact Mass | 469.12 |
| IUPAC Name | 3-[1-(2,3-dihydroxypropyl)-6-(trifluoromethyl)indol-3-yl]-4-(1H-indol-3-yl)pyrrole-2,5-dione |
| SMILES | O=C1NC(=O)C(c2cn(CC(O)CO)c3cc(C(F)(F)F)ccc23)=C1c1c[nH]c2ccccc12 |
| InChI | InChI=1S/C24H18F3N3O4/c25-24(26,27)12-5-6-15-17(10-30(19(15)7-12)9-13(32)11-31)21-20(22(33)29-23(21)34)16-8-28-18-4-2-1-3-14(16)18/h1-8,10,13,28,31-32H,9,11H2,(H,29,33,34) |
| InChIKey | LNQPPLQVSHYNRC-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 107.35 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.42 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|