C27H27N3O8 — CID 18947147
3-[1-(2,3-dihydroxypropyl)-5,6-dimethoxyindol-3-yl]-4-(5,6-dimethoxy-1H-indol-3-yl)pyrrole-2,5-dione (PubChem CID 18947147) has the molecular formula C27H27N3O8 and a molecular weight of 521.53 g/mol. Its IUPAC name is 3-[1-(2,3-dihydroxypropyl)-5,6-dimethoxyindol-3-yl]-4-(5,6-dimethoxy-1H-indol-3-yl)pyrrole-2,5-dione.
| Compound Name | 3-[1-(2,3-dihydroxypropyl)-5,6-dimethoxyindol-3-yl]-4-(5,6-dimethoxy-1H-indol-3-yl)pyrrole-2,5-dione |
|---|---|
| PubChem CID | 18947147 |
| Molecular Formula | C27H27N3O8 |
| Molecular Weight | 521.53 g/mol |
| Exact Mass | 521.18 |
| IUPAC Name | 3-[1-(2,3-dihydroxypropyl)-5,6-dimethoxyindol-3-yl]-4-(5,6-dimethoxy-1H-indol-3-yl)pyrrole-2,5-dione |
| SMILES | COc1cc2[nH]cc(C3=C(c4cn(CC(O)CO)c5cc(OC)c(OC)cc45)C(=O)NC3=O)c2cc1OC |
| InChI | InChI=1S/C27H27N3O8/c1-35-20-5-14-16(9-28-18(14)7-22(20)37-3)24-25(27(34)29-26(24)33)17-11-30(10-13(32)12-31)19-8-23(38-4)21(36-2)6-15(17)19/h5-9,11,13,28,31-32H,10,12H2,1-4H3,(H,29,33,34) |
| InChIKey | IOMSIJPHFIFZQO-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 144.27 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.53 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|