C29H32N4O3 — CID 67769335
3-[1-(3-amino-3-ethyl-2-hydroxypentyl)-5-methylindol-3-yl]-4-(5-methyl-1H-indol-3-yl)pyrrole-2,5-dione (PubChem CID 67769335) has the molecular formula C29H32N4O3 and a molecular weight of 484.60 g/mol. Its IUPAC name is 3-[1-(3-amino-3-ethyl-2-hydroxypentyl)-5-methylindol-3-yl]-4-(5-methyl-1H-indol-3-yl)pyrrole-2,5-dione.
| Compound Name | 3-[1-(3-amino-3-ethyl-2-hydroxypentyl)-5-methylindol-3-yl]-4-(5-methyl-1H-indol-3-yl)pyrrole-2,5-dione |
|---|---|
| PubChem CID | 67769335 |
| Molecular Formula | C29H32N4O3 |
| Molecular Weight | 484.60 g/mol |
| Exact Mass | 484.25 |
| IUPAC Name | 3-[1-(3-amino-3-ethyl-2-hydroxypentyl)-5-methylindol-3-yl]-4-(5-methyl-1H-indol-3-yl)pyrrole-2,5-dione |
| SMILES | CCC(N)(CC)C(O)Cn1cc(C2=C(c3c[nH]c4ccc(C)cc34)C(=O)NC2=O)c2cc(C)ccc21 |
| InChI | InChI=1S/C29H32N4O3/c1-5-29(30,6-2)24(34)15-33-14-21(19-12-17(4)8-10-23(19)33)26-25(27(35)32-28(26)36)20-13-31-22-9-7-16(3)11-18(20)22/h7-14,24,31,34H,5-6,15,30H2,1-4H3,(H,32,35,36) |
| InChIKey | AXYQNZTVNBETRF-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 113.14 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.60 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|