C29H26F6N4O2 — CID 22410399
3-[1-[3-(diethylamino)propyl]-5-(trifluoromethyl)indol-3-yl]-4-[5-(trifluoromethyl)-1H-indol-3-yl]pyrrole-2,5-dione (PubChem CID 22410399) has the molecular formula C29H26F6N4O2 and a molecular weight of 576.54 g/mol. Its IUPAC name is 3-[1-[3-(diethylamino)propyl]-5-(trifluoromethyl)indol-3-yl]-4-[5-(trifluoromethyl)-1H-indol-3-yl]pyrrole-2,5-dione.
| Compound Name | 3-[1-[3-(diethylamino)propyl]-5-(trifluoromethyl)indol-3-yl]-4-[5-(trifluoromethyl)-1H-indol-3-yl]pyrrole-2,5-dione |
|---|---|
| PubChem CID | 22410399 |
| Molecular Formula | C29H26F6N4O2 |
| Molecular Weight | 576.54 g/mol |
| Exact Mass | 576.20 |
| IUPAC Name | 3-[1-[3-(diethylamino)propyl]-5-(trifluoromethyl)indol-3-yl]-4-[5-(trifluoromethyl)-1H-indol-3-yl]pyrrole-2,5-dione |
| SMILES | CCN(CC)CCCn1cc(C2=C(c3c[nH]c4ccc(C(F)(F)F)cc34)C(=O)NC2=O)c2cc(C(F)(F)F)ccc21 |
| InChI | InChI=1S/C29H26F6N4O2/c1-3-38(4-2)10-5-11-39-15-21(19-13-17(29(33,34)35)7-9-23(19)39)25-24(26(40)37-27(25)41)20-14-36-22-8-6-16(12-18(20)22)28(30,31)32/h6-9,12-15,36H,3-5,10-11H2,1-2H3,(H,37,40,41) |
| InChIKey | HVFXSDRHEXAPFV-UHFFFAOYSA-N |
| XLogP | 6.46 |
| TPSA | 70.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.54 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|