C27H28N4O3 — CID 22410556
3-[1-[3-(diethylamino)propyl]-6-hydroxyindol-3-yl]-4-(1H-indol-3-yl)pyrrole-2,5-dione (PubChem CID 22410556) has the molecular formula C27H28N4O3 and a molecular weight of 456.55 g/mol. Its IUPAC name is 3-[1-[3-(diethylamino)propyl]-6-hydroxyindol-3-yl]-4-(1H-indol-3-yl)pyrrole-2,5-dione.
| Compound Name | 3-[1-[3-(diethylamino)propyl]-6-hydroxyindol-3-yl]-4-(1H-indol-3-yl)pyrrole-2,5-dione |
|---|---|
| PubChem CID | 22410556 |
| Molecular Formula | C27H28N4O3 |
| Molecular Weight | 456.55 g/mol |
| Exact Mass | 456.22 |
| IUPAC Name | 3-[1-[3-(diethylamino)propyl]-6-hydroxyindol-3-yl]-4-(1H-indol-3-yl)pyrrole-2,5-dione |
| SMILES | CCN(CC)CCCn1cc(C2=C(c3c[nH]c4ccccc34)C(=O)NC2=O)c2ccc(O)cc21 |
| InChI | InChI=1S/C27H28N4O3/c1-3-30(4-2)12-7-13-31-16-21(19-11-10-17(32)14-23(19)31)25-24(26(33)29-27(25)34)20-15-28-22-9-6-5-8-18(20)22/h5-6,8-11,14-16,28,32H,3-4,7,12-13H2,1-2H3,(H,29,33,34) |
| InChIKey | YJEVMUUCUHWSSP-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 90.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.55 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|