C34H34N4O3 — CID 22409374
3-[1-[3-(diethylamino)propyl]-7-phenylmethoxyindol-3-yl]-4-(1H-indol-3-yl)pyrrole-2,5-dione (PubChem CID 22409374) has the molecular formula C34H34N4O3 and a molecular weight of 546.67 g/mol. Its IUPAC name is 3-[1-[3-(diethylamino)propyl]-7-phenylmethoxyindol-3-yl]-4-(1H-indol-3-yl)pyrrole-2,5-dione.
| Compound Name | 3-[1-[3-(diethylamino)propyl]-7-phenylmethoxyindol-3-yl]-4-(1H-indol-3-yl)pyrrole-2,5-dione |
|---|---|
| PubChem CID | 22409374 |
| Molecular Formula | C34H34N4O3 |
| Molecular Weight | 546.67 g/mol |
| Exact Mass | 546.26 |
| IUPAC Name | 3-[1-[3-(diethylamino)propyl]-7-phenylmethoxyindol-3-yl]-4-(1H-indol-3-yl)pyrrole-2,5-dione |
| SMILES | CCN(CC)CCCn1cc(C2=C(c3c[nH]c4ccccc34)C(=O)NC2=O)c2cccc(OCc3ccccc3)c21 |
| InChI | InChI=1S/C34H34N4O3/c1-3-37(4-2)18-11-19-38-21-27(25-15-10-17-29(32(25)38)41-22-23-12-6-5-7-13-23)31-30(33(39)36-34(31)40)26-20-35-28-16-9-8-14-24(26)28/h5-10,12-17,20-21,35H,3-4,11,18-19,22H2,1-2H3,(H,36,39,40) |
| InChIKey | MMVWEDPMTGEWMJ-UHFFFAOYSA-N |
| XLogP | 6.00 |
| TPSA | 79.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.67 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|