C25H21F3N4O2 — CID 22410411
3-(1H-indol-3-yl)-4-[1-[3-(methylamino)propyl]-7-(trifluoromethyl)indol-3-yl]pyrrole-2,5-dione (PubChem CID 22410411) has the molecular formula C25H21F3N4O2 and a molecular weight of 466.46 g/mol. Its IUPAC name is 3-(1H-indol-3-yl)-4-[1-[3-(methylamino)propyl]-7-(trifluoromethyl)indol-3-yl]pyrrole-2,5-dione.
| Compound Name | 3-(1H-indol-3-yl)-4-[1-[3-(methylamino)propyl]-7-(trifluoromethyl)indol-3-yl]pyrrole-2,5-dione |
|---|---|
| PubChem CID | 22410411 |
| Molecular Formula | C25H21F3N4O2 |
| Molecular Weight | 466.46 g/mol |
| Exact Mass | 466.16 |
| IUPAC Name | 3-(1H-indol-3-yl)-4-[1-[3-(methylamino)propyl]-7-(trifluoromethyl)indol-3-yl]pyrrole-2,5-dione |
| SMILES | CNCCCn1cc(C2=C(c3c[nH]c4ccccc34)C(=O)NC2=O)c2cccc(C(F)(F)F)c21 |
| InChI | InChI=1S/C25H21F3N4O2/c1-29-10-5-11-32-13-17(15-7-4-8-18(22(15)32)25(26,27)28)21-20(23(33)31-24(21)34)16-12-30-19-9-3-2-6-14(16)19/h2-4,6-9,12-13,29-30H,5,10-11H2,1H3,(H,31,33,34) |
| InChIKey | KOAHJRJRFWGFJL-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 78.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.46 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|