C25H17F3N4O2S — CID 22409601
3-(1H-indol-3-yl)-4-[1-(3-isothiocyanatopropyl)-4-(trifluoromethyl)indol-3-yl]pyrrole-2,5-dione (PubChem CID 22409601) has the molecular formula C25H17F3N4O2S and a molecular weight of 494.50 g/mol. Its IUPAC name is 3-(1H-indol-3-yl)-4-[1-(3-isothiocyanatopropyl)-4-(trifluoromethyl)indol-3-yl]pyrrole-2,5-dione.
| Compound Name | 3-(1H-indol-3-yl)-4-[1-(3-isothiocyanatopropyl)-4-(trifluoromethyl)indol-3-yl]pyrrole-2,5-dione |
|---|---|
| PubChem CID | 22409601 |
| Molecular Formula | C25H17F3N4O2S |
| Molecular Weight | 494.50 g/mol |
| Exact Mass | 494.10 |
| IUPAC Name | 3-(1H-indol-3-yl)-4-[1-(3-isothiocyanatopropyl)-4-(trifluoromethyl)indol-3-yl]pyrrole-2,5-dione |
| SMILES | O=C1NC(=O)C(c2cn(CCCN=C=S)c3cccc(C(F)(F)F)c23)=C1c1c[nH]c2ccccc12 |
| InChI | InChI=1S/C25H17F3N4O2S/c26-25(27,28)17-6-3-8-19-20(17)16(12-32(19)10-4-9-29-13-35)22-21(23(33)31-24(22)34)15-11-30-18-7-2-1-5-14(15)18/h1-3,5-8,11-12,30H,4,9-10H2,(H,31,33,34) |
| InChIKey | MMPOIEDFZYDRTO-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 79.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.50 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|