C24H17BrN4O2S — CID 22409607
3-[5-bromo-1-(3-isothiocyanatopropyl)indol-3-yl]-4-(1H-indol-3-yl)pyrrole-2,5-dione (PubChem CID 22409607) has the molecular formula C24H17BrN4O2S and a molecular weight of 505.40 g/mol. Its IUPAC name is 3-[5-bromo-1-(3-isothiocyanatopropyl)indol-3-yl]-4-(1H-indol-3-yl)pyrrole-2,5-dione.
| Compound Name | 3-[5-bromo-1-(3-isothiocyanatopropyl)indol-3-yl]-4-(1H-indol-3-yl)pyrrole-2,5-dione |
|---|---|
| PubChem CID | 22409607 |
| Molecular Formula | C24H17BrN4O2S |
| Molecular Weight | 505.40 g/mol |
| Exact Mass | 504.03 |
| IUPAC Name | 3-[5-bromo-1-(3-isothiocyanatopropyl)indol-3-yl]-4-(1H-indol-3-yl)pyrrole-2,5-dione |
| SMILES | O=C1NC(=O)C(c2cn(CCCN=C=S)c3ccc(Br)cc23)=C1c1c[nH]c2ccccc12 |
| InChI | InChI=1S/C24H17BrN4O2S/c25-14-6-7-20-16(10-14)18(12-29(20)9-3-8-26-13-32)22-21(23(30)28-24(22)31)17-11-27-19-5-2-1-4-15(17)19/h1-2,4-7,10-12,27H,3,8-9H2,(H,28,30,31) |
| InChIKey | PBYVZLCTNWVLDK-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 79.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.40 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|