C24H20BrN7O4 — CID 22409989
2-[3-[5-bromo-3-[4-(1H-indol-3-yl)-2,5-dioxopyrrol-3-yl]indol-1-yl]propyl]-1-nitroguanidine (PubChem CID 22409989) has the molecular formula C24H20BrN7O4 and a molecular weight of 550.37 g/mol. Its IUPAC name is 2-[3-[5-bromo-3-[4-(1H-indol-3-yl)-2,5-dioxopyrrol-3-yl]indol-1-yl]propyl]-1-nitroguanidine.
| Compound Name | 2-[3-[5-bromo-3-[4-(1H-indol-3-yl)-2,5-dioxopyrrol-3-yl]indol-1-yl]propyl]-1-nitroguanidine |
|---|---|
| PubChem CID | 22409989 |
| Molecular Formula | C24H20BrN7O4 |
| Molecular Weight | 550.37 g/mol |
| Exact Mass | 549.08 |
| IUPAC Name | 2-[3-[5-bromo-3-[4-(1H-indol-3-yl)-2,5-dioxopyrrol-3-yl]indol-1-yl]propyl]-1-nitroguanidine |
| SMILES | N/C(=N\CCCn1cc(C2=C(c3c[nH]c4ccccc34)C(=O)NC2=O)c2cc(Br)ccc21)N[N+](=O)[O-] |
| InChI | InChI=1S/C24H20BrN7O4/c25-13-6-7-19-15(10-13)17(12-31(19)9-3-8-27-24(26)30-32(35)36)21-20(22(33)29-23(21)34)16-11-28-18-5-2-1-4-14(16)18/h1-2,4-7,10-12,28H,3,8-9H2,(H3,26,27,30)(H,29,33,34) |
| InChIKey | ROSJWTPAAQRFSB-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 160.44 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.37 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'N-nitroso', 'substructure': 'N/A'} |
|---|