C24H23N9O4 — CID 22409873
2-[3-[5-amino-3-[4-(5-amino-1H-indol-3-yl)-2,5-dioxopyrrol-3-yl]indol-1-yl]propyl]-1-nitroguanidine (PubChem CID 22409873) has the molecular formula C24H23N9O4 and a molecular weight of 501.51 g/mol. Its IUPAC name is 2-[3-[5-amino-3-[4-(5-amino-1H-indol-3-yl)-2,5-dioxopyrrol-3-yl]indol-1-yl]propyl]-1-nitroguanidine.
| Compound Name | 2-[3-[5-amino-3-[4-(5-amino-1H-indol-3-yl)-2,5-dioxopyrrol-3-yl]indol-1-yl]propyl]-1-nitroguanidine |
|---|---|
| PubChem CID | 22409873 |
| Molecular Formula | C24H23N9O4 |
| Molecular Weight | 501.51 g/mol |
| Exact Mass | 501.19 |
| IUPAC Name | 2-[3-[5-amino-3-[4-(5-amino-1H-indol-3-yl)-2,5-dioxopyrrol-3-yl]indol-1-yl]propyl]-1-nitroguanidine |
| SMILES | N/C(=N\CCCn1cc(C2=C(c3c[nH]c4ccc(N)cc34)C(=O)NC2=O)c2cc(N)ccc21)N[N+](=O)[O-] |
| InChI | InChI=1S/C24H23N9O4/c25-12-2-4-18-14(8-12)16(10-29-18)20-21(23(35)30-22(20)34)17-11-32(19-5-3-13(26)9-15(17)19)7-1-6-28-24(27)31-33(36)37/h2-5,8-11,29H,1,6-7,25-26H2,(H3,27,28,31)(H,30,34,35) |
| InChIKey | GYBGQJNWPFAMEY-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 212.48 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.51 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'} |
|---|