C25H23N3O3 — CID 22410438
3-[1-(3-hydroxypropyl)-5-methylindol-3-yl]-4-(5-methyl-1H-indol-3-yl)pyrrole-2,5-dione (PubChem CID 22410438) has the molecular formula C25H23N3O3 and a molecular weight of 413.48 g/mol. Its IUPAC name is 3-[1-(3-hydroxypropyl)-5-methylindol-3-yl]-4-(5-methyl-1H-indol-3-yl)pyrrole-2,5-dione.
| Compound Name | 3-[1-(3-hydroxypropyl)-5-methylindol-3-yl]-4-(5-methyl-1H-indol-3-yl)pyrrole-2,5-dione |
|---|---|
| PubChem CID | 22410438 |
| Molecular Formula | C25H23N3O3 |
| Molecular Weight | 413.48 g/mol |
| Exact Mass | 413.17 |
| IUPAC Name | 3-[1-(3-hydroxypropyl)-5-methylindol-3-yl]-4-(5-methyl-1H-indol-3-yl)pyrrole-2,5-dione |
| SMILES | Cc1ccc2[nH]cc(C3=C(c4cn(CCCO)c5ccc(C)cc45)C(=O)NC3=O)c2c1 |
| InChI | InChI=1S/C25H23N3O3/c1-14-4-6-20-16(10-14)18(12-26-20)22-23(25(31)27-24(22)30)19-13-28(8-3-9-29)21-7-5-15(2)11-17(19)21/h4-7,10-13,26,29H,3,8-9H2,1-2H3,(H,27,30,31) |
| InChIKey | YFUKYDCBIVZZJI-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 87.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.48 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|