C29H34N6O2 — CID 22409690
3-[5-(dimethylamino)-1-[3-(ethylamino)propyl]indol-3-yl]-4-[5-(dimethylamino)-1H-indol-3-yl]pyrrole-2,5-dione (PubChem CID 22409690) has the molecular formula C29H34N6O2 and a molecular weight of 498.63 g/mol. Its IUPAC name is 3-[5-(dimethylamino)-1-[3-(ethylamino)propyl]indol-3-yl]-4-[5-(dimethylamino)-1H-indol-3-yl]pyrrole-2,5-dione.
| Compound Name | 3-[5-(dimethylamino)-1-[3-(ethylamino)propyl]indol-3-yl]-4-[5-(dimethylamino)-1H-indol-3-yl]pyrrole-2,5-dione |
|---|---|
| PubChem CID | 22409690 |
| Molecular Formula | C29H34N6O2 |
| Molecular Weight | 498.63 g/mol |
| Exact Mass | 498.27 |
| IUPAC Name | 3-[5-(dimethylamino)-1-[3-(ethylamino)propyl]indol-3-yl]-4-[5-(dimethylamino)-1H-indol-3-yl]pyrrole-2,5-dione |
| SMILES | CCNCCCn1cc(C2=C(c3c[nH]c4ccc(N(C)C)cc34)C(=O)NC2=O)c2cc(N(C)C)ccc21 |
| InChI | InChI=1S/C29H34N6O2/c1-6-30-12-7-13-35-17-23(21-15-19(34(4)5)9-11-25(21)35)27-26(28(36)32-29(27)37)22-16-31-24-10-8-18(33(2)3)14-20(22)24/h8-11,14-17,30-31H,6-7,12-13H2,1-5H3,(H,32,36,37) |
| InChIKey | QWOCVOKXTYMUDL-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 85.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.63 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|