C24H18N4O3S — CID 22410190
3-[5-hydroxy-1-(3-isothiocyanatopropyl)indol-3-yl]-4-(1H-indol-3-yl)pyrrole-2,5-dione (PubChem CID 22410190) has the molecular formula C24H18N4O3S and a molecular weight of 442.50 g/mol. Its IUPAC name is 3-[5-hydroxy-1-(3-isothiocyanatopropyl)indol-3-yl]-4-(1H-indol-3-yl)pyrrole-2,5-dione.
| Compound Name | 3-[5-hydroxy-1-(3-isothiocyanatopropyl)indol-3-yl]-4-(1H-indol-3-yl)pyrrole-2,5-dione |
|---|---|
| PubChem CID | 22410190 |
| Molecular Formula | C24H18N4O3S |
| Molecular Weight | 442.50 g/mol |
| Exact Mass | 442.11 |
| IUPAC Name | 3-[5-hydroxy-1-(3-isothiocyanatopropyl)indol-3-yl]-4-(1H-indol-3-yl)pyrrole-2,5-dione |
| SMILES | O=C1NC(=O)C(c2cn(CCCN=C=S)c3ccc(O)cc23)=C1c1c[nH]c2ccccc12 |
| InChI | InChI=1S/C24H18N4O3S/c29-14-6-7-20-16(10-14)18(12-28(20)9-3-8-25-13-32)22-21(23(30)27-24(22)31)17-11-26-19-5-2-1-4-15(17)19/h1-2,4-7,10-12,26,29H,3,8-9H2,(H,27,30,31) |
| InChIKey | PHAYDCXJUDDRNV-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 99.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.50 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|