C26H19F6N7O4 — CID 22409760
2-[3-[3-[2,5-dioxo-4-[5-(trifluoromethyl)-1H-indol-3-yl]pyrrol-3-yl]-5-(trifluoromethyl)indol-1-yl]propyl]-1-nitroguanidine (PubChem CID 22409760) has the molecular formula C26H19F6N7O4 and a molecular weight of 607.47 g/mol. Its IUPAC name is 2-[3-[3-[2,5-dioxo-4-[5-(trifluoromethyl)-1H-indol-3-yl]pyrrol-3-yl]-5-(trifluoromethyl)indol-1-yl]propyl]-1-nitroguanidine.
| Compound Name | 2-[3-[3-[2,5-dioxo-4-[5-(trifluoromethyl)-1H-indol-3-yl]pyrrol-3-yl]-5-(trifluoromethyl)indol-1-yl]propyl]-1-nitroguanidine |
|---|---|
| PubChem CID | 22409760 |
| Molecular Formula | C26H19F6N7O4 |
| Molecular Weight | 607.47 g/mol |
| Exact Mass | 607.14 |
| IUPAC Name | 2-[3-[3-[2,5-dioxo-4-[5-(trifluoromethyl)-1H-indol-3-yl]pyrrol-3-yl]-5-(trifluoromethyl)indol-1-yl]propyl]-1-nitroguanidine |
| SMILES | N/C(=N\CCCn1cc(C2=C(c3c[nH]c4ccc(C(F)(F)F)cc34)C(=O)NC2=O)c2cc(C(F)(F)F)ccc21)N[N+](=O)[O-] |
| InChI | InChI=1S/C26H19F6N7O4/c27-25(28,29)12-2-4-18-14(8-12)16(10-35-18)20-21(23(41)36-22(20)40)17-11-38(7-1-6-34-24(33)37-39(42)43)19-5-3-13(9-15(17)19)26(30,31)32/h2-5,8-11,35H,1,6-7H2,(H3,33,34,37)(H,36,40,41) |
| InChIKey | WZYGGQQQNSYMOB-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 160.44 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 607.47 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'N-nitroso', 'substructure': 'N/A'} |
|---|