C26H25N7O6 — CID 22410022
2-[3-[3-[4-(1H-indol-3-yl)-2,5-dioxopyrrol-3-yl]-4,5-dimethoxyindol-1-yl]propyl]-1-nitroguanidine (PubChem CID 22410022) has the molecular formula C26H25N7O6 and a molecular weight of 531.53 g/mol. Its IUPAC name is 2-[3-[3-[4-(1H-indol-3-yl)-2,5-dioxopyrrol-3-yl]-4,5-dimethoxyindol-1-yl]propyl]-1-nitroguanidine.
| Compound Name | 2-[3-[3-[4-(1H-indol-3-yl)-2,5-dioxopyrrol-3-yl]-4,5-dimethoxyindol-1-yl]propyl]-1-nitroguanidine |
|---|---|
| PubChem CID | 22410022 |
| Molecular Formula | C26H25N7O6 |
| Molecular Weight | 531.53 g/mol |
| Exact Mass | 531.19 |
| IUPAC Name | 2-[3-[3-[4-(1H-indol-3-yl)-2,5-dioxopyrrol-3-yl]-4,5-dimethoxyindol-1-yl]propyl]-1-nitroguanidine |
| SMILES | COc1ccc2c(c(C3=C(c4c[nH]c5ccccc45)C(=O)NC3=O)cn2CCC/N=C(\N)N[N+](=O)[O-])c1OC |
| InChI | InChI=1S/C26H25N7O6/c1-38-19-9-8-18-20(23(19)39-2)16(13-32(18)11-5-10-28-26(27)31-33(36)37)22-21(24(34)30-25(22)35)15-12-29-17-7-4-3-6-14(15)17/h3-4,6-9,12-13,29H,5,10-11H2,1-2H3,(H3,27,28,31)(H,30,34,35) |
| InChIKey | ZPZWBIFMCLHPKD-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 178.90 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.53 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'N-nitroso', 'substructure': 'N/A'} |
|---|