C30H34N4O6 — CID 22409598
3-[1-[2-(diethylamino)ethyl]-4,5-dimethoxyindol-3-yl]-4-(4,5-dimethoxy-1H-indol-3-yl)pyrrole-2,5-dione (PubChem CID 22409598) has the molecular formula C30H34N4O6 and a molecular weight of 546.62 g/mol. Its IUPAC name is 3-[1-[2-(diethylamino)ethyl]-4,5-dimethoxyindol-3-yl]-4-(4,5-dimethoxy-1H-indol-3-yl)pyrrole-2,5-dione.
| Compound Name | 3-[1-[2-(diethylamino)ethyl]-4,5-dimethoxyindol-3-yl]-4-(4,5-dimethoxy-1H-indol-3-yl)pyrrole-2,5-dione |
|---|---|
| PubChem CID | 22409598 |
| Molecular Formula | C30H34N4O6 |
| Molecular Weight | 546.62 g/mol |
| Exact Mass | 546.25 |
| IUPAC Name | 3-[1-[2-(diethylamino)ethyl]-4,5-dimethoxyindol-3-yl]-4-(4,5-dimethoxy-1H-indol-3-yl)pyrrole-2,5-dione |
| SMILES | CCN(CC)CCn1cc(C2=C(c3c[nH]c4ccc(OC)c(OC)c34)C(=O)NC2=O)c2c(OC)c(OC)ccc21 |
| InChI | InChI=1S/C30H34N4O6/c1-7-33(8-2)13-14-34-16-18(24-20(34)10-12-22(38-4)28(24)40-6)26-25(29(35)32-30(26)36)17-15-31-19-9-11-21(37-3)27(39-5)23(17)19/h9-12,15-16,31H,7-8,13-14H2,1-6H3,(H,32,35,36) |
| InChIKey | IRCPKMSONNDMOL-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 107.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.62 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|