C29H32N4O4 — CID 22409408
3-[1-[3-(diethylamino)propyl]-4,5-dimethoxyindol-3-yl]-4-(1H-indol-3-yl)pyrrole-2,5-dione (PubChem CID 22409408) has the molecular formula C29H32N4O4 and a molecular weight of 500.60 g/mol. Its IUPAC name is 3-[1-[3-(diethylamino)propyl]-4,5-dimethoxyindol-3-yl]-4-(1H-indol-3-yl)pyrrole-2,5-dione.
| Compound Name | 3-[1-[3-(diethylamino)propyl]-4,5-dimethoxyindol-3-yl]-4-(1H-indol-3-yl)pyrrole-2,5-dione |
|---|---|
| PubChem CID | 22409408 |
| Molecular Formula | C29H32N4O4 |
| Molecular Weight | 500.60 g/mol |
| Exact Mass | 500.24 |
| IUPAC Name | 3-[1-[3-(diethylamino)propyl]-4,5-dimethoxyindol-3-yl]-4-(1H-indol-3-yl)pyrrole-2,5-dione |
| SMILES | CCN(CC)CCCn1cc(C2=C(c3c[nH]c4ccccc34)C(=O)NC2=O)c2c(OC)c(OC)ccc21 |
| InChI | InChI=1S/C29H32N4O4/c1-5-32(6-2)14-9-15-33-17-20(24-22(33)12-13-23(36-3)27(24)37-4)26-25(28(34)31-29(26)35)19-16-30-21-11-8-7-10-18(19)21/h7-8,10-13,16-17,30H,5-6,9,14-15H2,1-4H3,(H,31,34,35) |
| InChIKey | BJHGIINEBJYYIP-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 88.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.60 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|