C25H23N3O6 — CID 22409400
3-[1-(2,3-dihydroxypropyl)-4,5-dimethoxyindol-3-yl]-4-(1H-indol-3-yl)pyrrole-2,5-dione (PubChem CID 22409400) has the molecular formula C25H23N3O6 and a molecular weight of 461.47 g/mol. Its IUPAC name is 3-[1-(2,3-dihydroxypropyl)-4,5-dimethoxyindol-3-yl]-4-(1H-indol-3-yl)pyrrole-2,5-dione.
| Compound Name | 3-[1-(2,3-dihydroxypropyl)-4,5-dimethoxyindol-3-yl]-4-(1H-indol-3-yl)pyrrole-2,5-dione |
|---|---|
| PubChem CID | 22409400 |
| Molecular Formula | C25H23N3O6 |
| Molecular Weight | 461.47 g/mol |
| Exact Mass | 461.16 |
| IUPAC Name | 3-[1-(2,3-dihydroxypropyl)-4,5-dimethoxyindol-3-yl]-4-(1H-indol-3-yl)pyrrole-2,5-dione |
| SMILES | COc1ccc2c(c(C3=C(c4c[nH]c5ccccc45)C(=O)NC3=O)cn2CC(O)CO)c1OC |
| InChI | InChI=1S/C25H23N3O6/c1-33-19-8-7-18-20(23(19)34-2)16(11-28(18)10-13(30)12-29)22-21(24(31)27-25(22)32)15-9-26-17-6-4-3-5-14(15)17/h3-9,11,13,26,29-30H,10,12H2,1-2H3,(H,27,31,32) |
| InChIKey | ARFRNWLBPGHKQU-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 125.81 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.47 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|