C25H23BrN4O3 — CID 22409298
3-[5-bromo-1-[3-(dimethylamino)-2-hydroxypropyl]indol-3-yl]-4-(1H-indol-3-yl)pyrrole-2,5-dione (PubChem CID 22409298) has the molecular formula C25H23BrN4O3 and a molecular weight of 507.39 g/mol. Its IUPAC name is 3-[5-bromo-1-[3-(dimethylamino)-2-hydroxypropyl]indol-3-yl]-4-(1H-indol-3-yl)pyrrole-2,5-dione.
| Compound Name | 3-[5-bromo-1-[3-(dimethylamino)-2-hydroxypropyl]indol-3-yl]-4-(1H-indol-3-yl)pyrrole-2,5-dione |
|---|---|
| PubChem CID | 22409298 |
| Molecular Formula | C25H23BrN4O3 |
| Molecular Weight | 507.39 g/mol |
| Exact Mass | 506.10 |
| IUPAC Name | 3-[5-bromo-1-[3-(dimethylamino)-2-hydroxypropyl]indol-3-yl]-4-(1H-indol-3-yl)pyrrole-2,5-dione |
| SMILES | CN(C)CC(O)Cn1cc(C2=C(c3c[nH]c4ccccc34)C(=O)NC2=O)c2cc(Br)ccc21 |
| InChI | InChI=1S/C25H23BrN4O3/c1-29(2)11-15(31)12-30-13-19(17-9-14(26)7-8-21(17)30)23-22(24(32)28-25(23)33)18-10-27-20-6-4-3-5-16(18)20/h3-10,13,15,27,31H,11-12H2,1-2H3,(H,28,32,33) |
| InChIKey | XUIPMHGCNUNNJG-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 90.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.39 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|