C33H32N4O4 — CID 22409335
3-[1-[3-(dimethylamino)-2-methoxypropyl]-5-phenylmethoxyindol-3-yl]-4-(1H-indol-3-yl)pyrrole-2,5-dione (PubChem CID 22409335) has the molecular formula C33H32N4O4 and a molecular weight of 548.64 g/mol. Its IUPAC name is 3-[1-[3-(dimethylamino)-2-methoxypropyl]-5-phenylmethoxyindol-3-yl]-4-(1H-indol-3-yl)pyrrole-2,5-dione.
| Compound Name | 3-[1-[3-(dimethylamino)-2-methoxypropyl]-5-phenylmethoxyindol-3-yl]-4-(1H-indol-3-yl)pyrrole-2,5-dione |
|---|---|
| PubChem CID | 22409335 |
| Molecular Formula | C33H32N4O4 |
| Molecular Weight | 548.64 g/mol |
| Exact Mass | 548.24 |
| IUPAC Name | 3-[1-[3-(dimethylamino)-2-methoxypropyl]-5-phenylmethoxyindol-3-yl]-4-(1H-indol-3-yl)pyrrole-2,5-dione |
| SMILES | COC(CN(C)C)Cn1cc(C2=C(c3c[nH]c4ccccc34)C(=O)NC2=O)c2cc(OCc3ccccc3)ccc21 |
| InChI | InChI=1S/C33H32N4O4/c1-36(2)17-23(40-3)18-37-19-27(25-15-22(13-14-29(25)37)41-20-21-9-5-4-6-10-21)31-30(32(38)35-33(31)39)26-16-34-28-12-8-7-11-24(26)28/h4-16,19,23,34H,17-18,20H2,1-3H3,(H,35,38,39) |
| InChIKey | LARDPAIDYKONOI-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 88.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.64 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|